Online Database of Chemicals from Around the World
|
CAS#: 885269-08-9 Product: 2-Amino-5-chloro-4-nitrobenzonitrile No suppilers available for the product. |
| Name | 2-Amino-5-chloro-4-nitrobenzonitrile |
|---|---|
| Synonyms | 2-Amino-5-chlor-4-nitrobenzonitril; 2-Amino-5-chloro-4-nitrobenzonitrile; 2-Amino-5-chloro-4-nitrobenzonitrile |
| Molecular Structure |  |
| Molecular Formula | C7H4ClN3O2 |
| Molecular Weight | 197.58 |
| CAS Registry Number | 885269-08-9 |
| SMILES | c1c(c(cc(c1Cl)[N+](=O)[O-])N)C#N |
| InChI | 1S/C7H4ClN3O2/c8-5-1-4(3-9)6(10)2-7(5)11(12)13/h1-2H,10H2 |
| InChIKey | LNXVDIDFFKBRLZ-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.4±45.0°C at 760 mmHg (Cal.) |
| Flash point | 208.0±28.7°C (Cal.) |
| Refractive index | 1.642 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-5-chloro-4-nitrobenzonitrile |