Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-indan-2-ylideneacetic acid |
|---|---|
| Synonyms | ACETIC ACID,2-(1,3-DIHYDRO-2H-INDEN-2-YLIDENE)-; Indan-2-ylidene-acetic acid; INDAN-2-YLIDENE-ACETICACID |
| Molecular Structure |  |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 |
| CAS Registry Number | 885269-67-0 |
| SMILES | c1ccc2c(c1)CC(=CC(=O)O)C2 |
| InChI | 1S/C11H10O2/c12-11(13)7-8-5-9-3-1-2-4-10(9)6-8/h1-4,7H,5-6H2,(H,12,13) |
| InChIKey | QZOQJTCXVPYKRI-UHFFFAOYSA-N |
| Density | 1.336g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.417°C at 760 mmHg (Cal.) |
| Flash point | 262.417°C (Cal.) |
| Refractive index | 1.709 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-indan-2-ylideneacetic acid |