Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 2330-8079751 | |||
|
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | 2-Methoxy-1-naphthalenecarboximidamide |
|---|---|
| Synonyms | 1-NAPHTHALENECARBOXIMIDAMIDE,2-METHOXY-; 2-Methoxy-naphthalene-1-carboxamidine; 2-methoxynaphthalene-1-carboximidamide |
| Molecular Structure |  |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 |
| CAS Registry Number | 885270-13-3 |
| SMILES | COC1=C(C2=CC=CC=C2C=C1)C(=N)N |
| InChI | 1S/C12H12N2O/c1-15-10-7-6-8-4-2-3-5-9(8)11(10)12(13)14/h2-7H,1H3,(H3,13,14) |
| InChIKey | RCIGPOBMYPKFBY-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.1±44.0°C at 760 mmHg (Cal.) |
| Flash point | 180.7±28.4°C (Cal.) |
| Refractive index | 1.604 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-1-naphthalenecarboximidamide |