| Acesys Pharmatech | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (800) 792-0471 / (908) 998-1240 | |||
![]() |
info@acesyspharma.com, | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Methyl (3R,4S)-4-(4-cyanophenyl)-3-pyrrolidinecarboxylate |
|---|---|
| Synonyms | methyl (4S,3R)-4-(4-cyanophenyl)pyrrolidine-3-carboxylate; Trans-methyl 4-(4-cyanophenyl)pyrrolidine-3-carboxylate; Trans-methyl 4-(4-cyanophenyl)pyrrolidine-3-carboxylate HCl |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.26 |
| CAS Registry Number | 885270-63-3 |
| SMILES | COC(=O)[C@H]1CNC[C@@H]1c2ccc(cc2)C#N |
| InChI | 1S/C13H14N2O2/c1-17-13(16)12-8-15-7-11(12)10-4-2-9(6-14)3-5-10/h2-5,11-12,15H,7-8H2,1H3/t11-,12+/m1/s1 |
| InChIKey | ZDBJRAVHOPFWTB-NEPJUHHUSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.819°C at 760 mmHg (Cal.) |
| Flash point | 181.694°C (Cal.) |
| Refractive index | 1.565 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (3R,4S)-4-(4-cyanophenyl)-3-pyrrolidinecarboxylate |