|
CAS#: 885270-64-4 Product: 2-[4-(2-Aminoethyl)phenyl]-N,N-diethylacetamide No suppilers available for the product. |
| Name | 2-[4-(2-Aminoethyl)phenyl]-N,N-diethylacetamide |
|---|---|
| Synonyms | 2-[4-(2-Aminoethyl)phenyl]-N,N-diethylacetamid; 2-[4-(2-Aminoethyl)phenyl]-N,N-diethylacetamide; 2-[4-(2-AMINO-ETHYL)-PHENYL]-N,N-DIETHYL-ACETAMIDE |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 |
| CAS Registry Number | 885270-64-4 |
| SMILES | CCN(CC)C(=O)Cc1ccc(cc1)CCN |
| InChI | 1S/C14H22N2O/c1-3-16(4-2)14(17)11-13-7-5-12(6-8-13)9-10-15/h5-8H,3-4,9-11,15H2,1-2H3 |
| InChIKey | JWIBWGRVKLDSGD-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.6±30.0°C at 760 mmHg (Cal.) |
| Flash point | 187.0±24.6°C (Cal.) |
| Refractive index | 1.533 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[4-(2-Aminoethyl)phenyl]-N,N-diethylacetamide |