|
CAS#: 885270-77-9 Product: 2-Methyl-2-propanyl (2-amino-5-methylphenyl)carbamate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl (2-amino-5-methylphenyl)carbamate |
|---|---|
| Synonyms | (2-Amino-5-méthylphényl)carbamate de 2-méthyl-2-propanyle; 2-Methyl-2-propanyl (2-amino-5-methylphenyl)carbamate; 2-Methyl-2-propanyl-(2-amino-5-methylphenyl)carbamat |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.28 |
| CAS Registry Number | 885270-77-9 |
| SMILES | Cc1ccc(c(c1)NC(=O)OC(C)(C)C)N |
| InChI | 1S/C12H18N2O2/c1-8-5-6-9(13)10(7-8)14-11(15)16-12(2,3)4/h5-7H,13H2,1-4H3,(H,14,15) |
| InChIKey | ITNKEMSWAOSDIT-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.4±33.0°C at 760 mmHg (Cal.) |
| Flash point | 131.9±25.4°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl (2-amino-5-methylphenyl)carbamate |