|
CAS#: 885270-99-5 Product: Ethyl 6,8-dichloro-2H-chromene-3-carboxylate No suppilers available for the product. |
| Name | Ethyl 6,8-dichloro-2H-chromene-3-carboxylate |
|---|---|
| Synonyms | 2H-1-Benz |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10Cl2O3 |
| Molecular Weight | 273.11 |
| CAS Registry Number | 885270-99-5 |
| SMILES | CCOC(=O)C1=Cc2cc(cc(c2OC1)Cl)Cl |
| InChI | 1S/C12H10Cl2O3/c1-2-16-12(15)8-3-7-4-9(13)5-10(14)11(7)17-6-8/h3-5H,2,6H2,1H3 |
| InChIKey | JMSVJTTYAKYOSL-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.1±42.0°C at 760 mmHg (Cal.) |
| Flash point | 161.8±26.9°C (Cal.) |
| Refractive index | 1.575 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 6,8-dichloro-2H-chromene-3-carboxylate |