|
CAS#: 885271-24-9 Product: 6-Bromo-8-methoxy-2H-chromene-3-carbonitrile No suppilers available for the product. |
| Name | 6-Bromo-8-methoxy-2H-chromene-3-carbonitrile |
|---|---|
| Synonyms | 2H-1-Benzopyran-3-carbonitrile, 6-bromo-8-methoxy-; 2H-1-BENZOPYRAN-3-CARBONITRILE,6-BROMO-8-METHOXY-; 6-Brom-8-methoxy-2H-chromen-3-carbonitril |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8BrNO2 |
| Molecular Weight | 266.09 |
| CAS Registry Number | 885271-24-9 |
| SMILES | COc1cc(cc2c1OCC(=C2)C#N)Br |
| InChI | 1S/C11H8BrNO2/c1-14-10-4-9(12)3-8-2-7(5-13)6-15-11(8)10/h2-4H,6H2,1H3 |
| InChIKey | DEZLOCCCPMXTEQ-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.6±42.0°C at 760 mmHg (Cal.) |
| Flash point | 188.2±27.9°C (Cal.) |
| Refractive index | 1.629 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Bromo-8-methoxy-2H-chromene-3-carbonitrile |