|
CAS#: 885271-32-9 Product: 6,8-Dibromo-2H-chromene-3-carbonitrile No suppilers available for the product. |
| Name | 6,8-Dibromo-2H-chromene-3-carbonitrile |
|---|---|
| Synonyms | 2H-1-Benzopyran-3-carbonitrile, 6,8-dibromo-; 2H-1-BENZOPYRAN-3-CARBONITRILE,6,8-DIBROMO-; 6,8-Dibrom-2H-chromen-3-carbonitril |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5Br2NO |
| Molecular Weight | 314.96 |
| CAS Registry Number | 885271-32-9 |
| SMILES | c1c(cc(c2c1C=C(CO2)C#N)Br)Br |
| InChI | 1S/C10H5Br2NO/c11-8-2-7-1-6(4-13)5-14-10(7)9(12)3-8/h1-3H,5H2 |
| InChIKey | UNBJABPYHGUFEQ-UHFFFAOYSA-N |
| Density | 2.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.9±45.0°C at 760 mmHg (Cal.) |
| Flash point | 201.1±28.7°C (Cal.) |
| Refractive index | 1.697 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,8-Dibromo-2H-chromene-3-carbonitrile |