Online Database of Chemicals from Around the World
|
CAS#: 885271-41-0 Product: 1-(8-Bromo-6-chloro-3,4-dihydro-2H-chromen-3-yl)methanamine No suppilers available for the product. |
| Name | 1-(8-Bromo-6-chloro-3,4-dihydro-2H-chromen-3-yl)methanamine |
|---|---|
| Synonyms | (8-BROMO-6-CHLORO-CHROMAN-3-YL)-METHYLAMINE |
| Molecular Structure |  |
| Molecular Formula | C10H11BrClNO |
| Molecular Weight | 276.56 |
| CAS Registry Number | 885271-41-0 |
| SMILES | C1C(COC2=C1C=C(C=C2Br)Cl)CN |
| InChI | 1S/C10H11BrClNO/c11-9-3-8(12)2-7-1-6(4-13)5-14-10(7)9/h2-3,6H,1,4-5,13H2 |
| InChIKey | MKQLMYGVDFOVDU-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.0±42.0°C at 760 mmHg (Cal.) |
| Flash point | 177.0±27.9°C (Cal.) |
| Refractive index | 1.59 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(8-Bromo-6-chloro-3,4-dihydro-2H-chromen-3-yl)methanamine |