|
CAS#: 885271-50-1 Product: Methyl 6,8-dichloro-3-chromanecarboxylate No suppilers available for the product. |
| Name | Methyl 6,8-dichloro-3-chromanecarboxylate |
|---|---|
| Synonyms | 2H-1-Benz |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10Cl2O3 |
| Molecular Weight | 261.10 |
| CAS Registry Number | 885271-50-1 |
| SMILES | COC(=O)C1Cc2cc(cc(c2OC1)Cl)Cl |
| InChI | 1S/C11H10Cl2O3/c1-15-11(14)7-2-6-3-8(12)4-9(13)10(6)16-5-7/h3-4,7H,2,5H2,1H3 |
| InChIKey | GEEZWTHQPWMOMW-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.6±42.0°C at 760 mmHg (Cal.) |
| Flash point | 149.4±26.9°C (Cal.) |
| Refractive index | 1.557 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 6,8-dichloro-3-chromanecarboxylate |