Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4-(1H-Indazol-6-yl)tetrahydro-2H-thiopyran-4-ol |
|---|---|
| Synonyms | 2H-Thiopyran-4-ol, tetrahydro-4-(1H-indazol-6-yl)-; 4-(1H-Indazol-6-yl)tetrahydro-2H-thiopyran-4-ol; 4-(1H-Indazol-6-yl)tetrahydro-2H-thiopyran-4-ol |
| Molecular Structure |  |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 |
| CAS Registry Number | 885272-21-9 |
| SMILES | c1cc2cn[nH]c2cc1C3(CCSCC3)O |
| InChI | 1S/C12H14N2OS/c15-12(3-5-16-6-4-12)10-2-1-9-8-13-14-11(9)7-10/h1-2,7-8,15H,3-6H2,(H,13,14) |
| InChIKey | IIXNPLQBOGAXCC-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.0±45.0°C at 760 mmHg (Cal.) |
| Flash point | 248.3±28.7°C (Cal.) |
| Refractive index | 1.719 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1H-Indazol-6-yl)tetrahydro-2H-thiopyran-4-ol |