Online Database of Chemicals from Around the World
|
CAS#: 885272-23-1 Product: Phenyl 7-amino-5-azaspiro[2.4]heptane-5-carboxylate No suppilers available for the product. |
| Name | Phenyl 7-amino-5-azaspiro[2.4]heptane-5-carboxylate |
|---|---|
| Synonyms | Phenyl-7-amino-5-azaspiro[2.4]heptane-5-carboxylate |
| Molecular Structure | ![CAS#: 885272-23-1， Phenyl 7-amino-5-azaspiro[2.4]heptane-5-carboxylate](/moreStructures/885272-23-1.gif) |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 |
| CAS Registry Number | 885272-23-1 |
| SMILES | c1ccc(cc1)OC(=O)N2CC(C3(C2)CC3)N |
| InChI | 1S/C13H16N2O2/c14-11-8-15(9-13(11)6-7-13)12(16)17-10-4-2-1-3-5-10/h1-5,11H,6-9,14H2 |
| InChIKey | ZNEKCVPQWWZGEM-UHFFFAOYSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.276°C at 760 mmHg (Cal.) |
| Flash point | 177.737°C (Cal.) |
| Refractive index | 1.626 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl 7-amino-5-azaspiro[2.4]heptane-5-carboxylate |