Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 5-(1-Benzofuran-2-yl)-2H-indazole |
|---|---|
| Synonyms | 2H-Indazole, 5-(2-benzofuranyl)-; 5-(1-Benzofuran-2-yl)-2H-indazol; 5-(1-Benzofuran-2-yl)-2H-indazole |
| Molecular Structure |  |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.25 |
| CAS Registry Number | 885272-61-7 |
| SMILES | c1ccc2c(c1)cc(o2)c3ccc4c(c3)c[nH]n4 |
| InChI | 1S/C15H10N2O/c1-2-4-14-10(3-1)8-15(18-14)11-5-6-13-12(7-11)9-16-17-13/h1-9H,(H,16,17) |
| InChIKey | SEOACZWIEFXVRE-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.4±24.0°C at 760 mmHg (Cal.) |
| Flash point | 155.6±16.9°C (Cal.) |
| Refractive index | 1.738 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(1-Benzofuran-2-yl)-2H-indazole |