Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-(3-Chlorophenyl)-1,3-oxazole-4-carbaldehyde |
|---|---|
| Synonyms | 2-(3-Chlorophenyl)-1,3-oxazole-4-carbaldehyde; 2-(3-Chlorophényl)-1,3-oxazole-4-carbaldéhyde; 2-(3-CHLORO-PHENYL)-OXAZOLE-4-CARBALDEHYDE |
| Molecular Structure |  |
| Molecular Formula | C10H6ClNO2 |
| Molecular Weight | 207.61 |
| CAS Registry Number | 885273-15-4 |
| SMILES | c1cc(cc(c1)Cl)c2nc(co2)C=O |
| InChI | 1S/C10H6ClNO2/c11-8-3-1-2-7(4-8)10-12-9(5-13)6-14-10/h1-6H |
| InChIKey | BBFSHCIZLJMBBV-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.8±48.0°C at 760 mmHg (Cal.) |
| Flash point | 175.0±29.6°C (Cal.) |
| Refractive index | 1.601 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Chlorophenyl)-1,3-oxazole-4-carbaldehyde |