Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 5-(Tetrahydro-2H-thiopyran-4-yl)-1H-indole |
|---|---|
| Synonyms | 1H-Indole, 5-(tetrahydro-2H-thiopyran-4-yl)-; 1H-INDOLE,5-(TETRAHYDRO-2H-THIOPYRAN-4-YL)-; 5-(Tetrahydro-2H-thiopyran-4-yl)-1H-indol |
| Molecular Structure |  |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.33 |
| CAS Registry Number | 885273-39-2 |
| SMILES | c1cc2c(cc[nH]2)cc1C3CCSCC3 |
| InChI | 1S/C13H15NS/c1-2-13-12(3-6-14-13)9-11(1)10-4-7-15-8-5-10/h1-3,6,9-10,14H,4-5,7-8H2 |
| InChIKey | KXRMDCMGCHDURS-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.7±38.0°C at 760 mmHg (Cal.) |
| Flash point | 205.8±26.8°C (Cal.) |
| Refractive index | 1.667 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Tetrahydro-2H-thiopyran-4-yl)-1H-indole |