Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1-[3-(3,5-Dimethylphenyl)-1,2-oxazol-5-yl]methanamine |
|---|---|
| Synonyms | 1-[3-(3,5-Dimethylphenyl)-1,2-oxazol-5-yl]methanamin; 1-[3-(3,5-Dimethylphenyl)-1,2-oxazol-5-yl]methanamine; 1-[3-(3,5-Diméthylphényl)-1,2-oxazol-5-yl]méthanamine |
| Molecular Structure | ![CAS#: 885273-62-1， 1-[3-(3,5-Dimethylphenyl)-1,2-oxazol-5-yl]methanamine](/moreStructures/885273-62-1.gif) |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.25 |
| CAS Registry Number | 885273-62-1 |
| SMILES | Cc1cc(cc(c1)c2cc(on2)CN)C |
| InChI | 1S/C12H14N2O/c1-8-3-9(2)5-10(4-8)12-6-11(7-13)15-14-12/h3-6H,7,13H2,1-2H3 |
| InChIKey | SZLKZVPHFUJXHL-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.7±37.0°C at 760 mmHg (Cal.) |
| Flash point | 164.7±26.5°C (Cal.) |
| Refractive index | 1.561 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-(3,5-Dimethylphenyl)-1,2-oxazol-5-yl]methanamine |