|
CAS#: 885274-90-8 Product: 2-Methyl-2-propanyl {4-[(4-oxo-1-piperidinyl)carbonyl]phenyl}carbamate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl {4-[(4-oxo-1-piperidinyl)carbonyl]phenyl}carbamate |
|---|---|
| Synonyms | {4-[(4-Ox |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 |
| CAS Registry Number | 885274-90-8 |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(cc1)C(=O)N2CCC(=O)CC2 |
| InChI | 1S/C17H22N2O4/c1-17(2,3)23-16(22)18-13-6-4-12(5-7-13)15(21)19-10-8-14(20)9-11-19/h4-7H,8-11H2,1-3H3,(H,18,22) |
| InChIKey | GECAEFBIYFYECB-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.5±40.0°C at 760 mmHg (Cal.) |
| Flash point | 231.7±27.3°C (Cal.) |
| Refractive index | 1.578 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl {4-[(4-oxo-1-piperidinyl)carbonyl]phenyl}carbamate |