|
CAS#: 885275-02-5 Product: 2-[4-(1-Piperazinyl)phenyl]-1,3-benzoxazole No suppilers available for the product. |
| Name | 2-[4-(1-Piperazinyl)phenyl]-1,3-benzoxazole |
|---|---|
| Synonyms | 2-(4-PIPERAZIN-1-YL-PHENYL)-BENZOOXAZOLE; 2-[4-(1-Piperazinyl)phenyl]-1,3-benzoxazol; 2-[4-(1-Piperazinyl)phenyl]-1,3-benzoxazole |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 |
| CAS Registry Number | 885275-02-5 |
| SMILES | c1ccc2c(c1)nc(o2)c3ccc(cc3)N4CCNCC4 |
| InChI | 1S/C17H17N3O/c1-2-4-16-15(3-1)19-17(21-16)13-5-7-14(8-6-13)20-11-9-18-10-12-20/h1-8,18H,9-12H2 |
| InChIKey | LCMNDMOKEJXAOT-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.1±30.0°C at 760 mmHg (Cal.) |
| Flash point | 226.6±24.6°C (Cal.) |
| Refractive index | 1.627 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[4-(1-Piperazinyl)phenyl]-1,3-benzoxazole |