|
CAS#: 885276-94-8 Product: [4-(4-Chlorophenyl)-1-piperazinyl](3-thienyl)acetic acid No suppilers available for the product. |
| Name | [4-(4-Chlorophenyl)-1-piperazinyl](3-thienyl)acetic acid |
|---|---|
| Synonyms | [4-(4-CHL |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17ClN2O2S |
| Molecular Weight | 336.84 |
| CAS Registry Number | 885276-94-8 |
| SMILES | C1CN(CCN1C2=CC=C(C=C2)Cl)C(C3=CSC=C3)C(=O)O |
| InChI | 1S/C16H17ClN2O2S/c17-13-1-3-14(4-2-13)18-6-8-19(9-7-18)15(16(20)21)12-5-10-22-11-12/h1-5,10-11,15H,6-9H2,(H,20,21) |
| InChIKey | YXSRJABCWQKIMY-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 507.0±50.0°C at 760 mmHg (Cal.) |
| Flash point | 260.4±30.1°C (Cal.) |
| Refractive index | 1.646 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-(4-Chlorophenyl)-1-piperazinyl](3-thienyl)acetic acid |