|
CAS#: 885276-96-0 Product: [4-(4-Chlorophenyl)-1-piperazinyl](2-naphthyl)acetic acid No suppilers available for the product. |
| Name | [4-(4-Chlorophenyl)-1-piperazinyl](2-naphthyl)acetic acid |
|---|---|
| Synonyms | [4-(4-CHL |
| Molecular Structure | ![]() |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.87 |
| CAS Registry Number | 885276-96-0 |
| SMILES | C1CN(CCN1C2=CC=C(C=C2)Cl)C(C3=CC4=CC=CC=C4C=C3)C(=O)O |
| InChI | 1S/C22H21ClN2O2/c23-19-7-9-20(10-8-19)24-11-13-25(14-12-24)21(22(26)27)18-6-5-16-3-1-2-4-17(16)15-18/h1-10,15,21H,11-14H2,(H,26,27) |
| InChIKey | BOEKPKYQMHQNEN-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 570.0±50.0°C at 760 mmHg (Cal.) |
| Flash point | 298.5±30.1°C (Cal.) |
| Refractive index | 1.671 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-(4-Chlorophenyl)-1-piperazinyl](2-naphthyl)acetic acid |