|
CAS#: 885277-07-6 Product: 3-[(4-Methyl-1,4-diazepan-1-yl)methyl]benzoic acid No suppilers available for the product. |
| Name | 3-[(4-Methyl-1,4-diazepan-1-yl)methyl]benzoic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.32 |
| CAS Registry Number | 885277-07-6 |
| SMILES | CN1CCCN(CC1)Cc2cccc(c2)C(=O)O |
| InChI | 1S/C14H20N2O2/c1-15-6-3-7-16(9-8-15)11-12-4-2-5-13(10-12)14(17)18/h2,4-5,10H,3,6-9,11H2,1H3,(H,17,18) |
| InChIKey | HZVHQQUCGJKEAH-UHFFFAOYSA-N |
| Density | 1.144g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.533°C at 760 mmHg (Cal.) |
| Flash point | 190.592°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(4-Methyl-1,4-diazepan-1-yl)methyl]benzoic acid |