Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-(5-Chloro-2-pyridinyl)aniline |
|---|---|
| Synonyms | 2-(5-Chlor-2-pyridinyl)anilin; 2-(5-Chloro-2-pyridinyl)aniline; 2-(5-Chloro-2-pyridinyl)aniline |
| Molecular Structure |  |
| Molecular Formula | C11H9ClN2 |
| Molecular Weight | 204.66 |
| CAS Registry Number | 885277-20-3 |
| SMILES | c1ccc(c(c1)c2ccc(cn2)Cl)N |
| InChI | 1S/C11H9ClN2/c12-8-5-6-11(14-7-8)9-3-1-2-4-10(9)13/h1-7H,13H2 |
| InChIKey | OVRZCDASEQJIEK-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.5±27.0°C at 760 mmHg (Cal.) |
| Flash point | 157.3±23.7°C (Cal.) |
| Refractive index | 1.635 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(5-Chloro-2-pyridinyl)aniline |