Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4,7-Dichloro-2-(4-methoxyphenyl)quinazoline |
|---|---|
| Synonyms | 4,7-Dichlor-2-(4-methoxyphenyl)chinazolin; 4,7-Dichloro-2-(4-methoxyphenyl)quinazoline; 4,7-Dichloro-2-(4-méthoxyphényl)quinazoline |
| Molecular Structure |  |
| Molecular Formula | C15H10Cl2N2O |
| Molecular Weight | 305.16 |
| CAS Registry Number | 885277-24-7 |
| SMILES | COc1ccc(cc1)c2nc3cc(ccc3c(n2)Cl)Cl |
| InChI | 1S/C15H10Cl2N2O/c1-20-11-5-2-9(3-6-11)15-18-13-8-10(16)4-7-12(13)14(17)19-15/h2-8H,1H3 |
| InChIKey | MXKDYHWFGRGCPT-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.5±34.0°C at 760 mmHg (Cal.) |
| Flash point | 143.4±25.7°C (Cal.) |
| Refractive index | 1.649 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,7-Dichloro-2-(4-methoxyphenyl)quinazoline |