|
CAS#: 885277-50-9 Product: 4-Chloro-6-fluoro-2-(2-fluorophenyl)quinazoline No suppilers available for the product. |
| Name | 4-Chloro-6-fluoro-2-(2-fluorophenyl)quinazoline |
|---|---|
| Synonyms | 4-Chlor-6-fluor-2-(2-fluorphenyl)chinazolin; 4-Chloro-6-fluoro-2-(2-fluorophenyl)quinazoline; 4-CHLORO-6-FLUORO-2-(2-FLUORO-PHENYL)-QUINAZOLINE |
| Molecular Structure | ![]() |
| Molecular Formula | C14H7ClF2N2 |
| Molecular Weight | 276.67 |
| CAS Registry Number | 885277-50-9 |
| SMILES | c1ccc(c(c1)c2nc3ccc(cc3c(n2)Cl)F)F |
| InChI | 1S/C14H7ClF2N2/c15-13-10-7-8(16)5-6-12(10)18-14(19-13)9-3-1-2-4-11(9)17/h1-7H |
| InChIKey | OSAXYMSBOKBMKC-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.8±42.0°C at 760 mmHg (Cal.) |
| Flash point | 139.3±27.9°C (Cal.) |
| Refractive index | 1.632 (Cal.) |
| Safety Description | IRRITANT |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-6-fluoro-2-(2-fluorophenyl)quinazoline |