Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
|
+44 (845) 299-6009/ | |||
|
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 4,7-dichloro-2-(4-chlorophenyl)quinazoline |
|---|---|
| Synonyms | 4,7-Dichloro-2-(4-chlorophenyl)quinazoline; Quinazoline, 4,7-dichloro-2-(4-chlorophenyl)-; QUINAZOLINE,4,7-DICHLORO-2-(4-CHLOROPHENYL)- |
| Molecular Structure |  |
| Molecular Formula | C14H7Cl3N2 |
| Molecular Weight | 309.58 |
| CAS Registry Number | 885277-72-5 |
| SMILES | c1cc(ccc1c2nc3cc(ccc3c(n2)Cl)Cl)Cl |
| InChI | 1S/C14H7Cl3N2/c15-9-3-1-8(2-4-9)14-18-12-7-10(16)5-6-11(12)13(17)19-14/h1-7H |
| InChIKey | YOGUTECHLRFSNY-UHFFFAOYSA-N |
| Density | 1.466g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.013°C at 760 mmHg (Cal.) |
| Flash point | 164.222°C (Cal.) |
| Refractive index | 1.677 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,7-dichloro-2-(4-chlorophenyl)quinazoline |