Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-(2-Bromo-1-phenylethyl)-3-chlorobenzene |
|---|---|
| Synonyms | 1-(2-Brom-1-phenylethyl)-3-chlorbenzol; 1-(2-Bromo-1-phenylethyl)-3-chlorobenzene; 1-(2-Bromo-1-phényléthyl)-3-chlorobenzène |
| Molecular Structure |  |
| Molecular Formula | C14H12BrCl |
| Molecular Weight | 295.60 |
| CAS Registry Number | 885279-71-0 |
| SMILES | c1ccc(cc1)C(CBr)c2cccc(c2)Cl |
| InChI | 1S/C14H12BrCl/c15-10-14(11-5-2-1-3-6-11)12-7-4-8-13(16)9-12/h1-9,14H,10H2 |
| InChIKey | STYAQVJVPDKLKA-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.9±27.0°C at 760 mmHg (Cal.) |
| Flash point | 191.2±13.8°C (Cal.) |
| Refractive index | 1.606 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Bromo-1-phenylethyl)-3-chlorobenzene |