Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1-[2-(2-Bromophenyl)-1,3-thiazol-4-yl]methanamine |
|---|---|
| Synonyms | 1-[2-(2-Bromophenyl)-1,3-thiazol-4-yl]methanamine; 1-[2-(2-Bromophényl)-1,3-thiazol-4-yl]méthanamine; 1-[2-(2-Bromphenyl)-1,3-thiazol-4-yl]methanamin |
| Molecular Structure | ![CAS#: 885280-21-7， 1-[2-(2-Bromophenyl)-1,3-thiazol-4-yl]methanamine](/moreStructures/885280-21-7.gif) |
| Molecular Formula | C10H9BrN2S |
| Molecular Weight | 269.16 |
| CAS Registry Number | 885280-21-7 |
| SMILES | c1ccc(c(c1)c2nc(cs2)CN)Br |
| InChI | 1S/C10H9BrN2S/c11-9-4-2-1-3-8(9)10-13-7(5-12)6-14-10/h1-4,6H,5,12H2 |
| InChIKey | ZZZQAZNPNXHCJN-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.5±55.0°C at 760 mmHg (Cal.) |
| Flash point | 199.1±31.5°C (Cal.) |
| Refractive index | 1.652 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2-(2-Bromophenyl)-1,3-thiazol-4-yl]methanamine |