Online Database of Chemicals from Around the World
|
CAS#: 88607-66-3 Product: 2-(4-Hydroxyphenyl)-7-methoxy-8-(2-pyrrolidinyl)-5-chromanol No suppilers available for the product. |
| Name | 2-(4-Hydroxyphenyl)-7-methoxy-8-(2-pyrrolidinyl)-5-chromanol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.40 |
| CAS Registry Number | 88607-66-3 |
| SMILES | Oc1ccc(cc1)C3Oc2c(c(OC)cc(O)c2CC3)C4NCCC4 |
| InChI | 1S/C20H23NO4/c1-24-18-11-16(23)14-8-9-17(12-4-6-13(22)7-5-12)25-20(14)19(18)15-3-2-10-21-15/h4-7,11,15,17,21-23H,2-3,8-10H2,1H3 |
| InChIKey | LEVIHKALYBTAAA-UHFFFAOYSA-N |
| Density | 1.256g/cm3 (Cal.) |
|---|---|
| Boiling point | 541.603°C at 760 mmHg (Cal.) |
| Flash point | 281.352°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Hydroxyphenyl)-7-methoxy-8-(2-pyrrolidinyl)-5-chromanol |