Online Database of Chemicals from Around the World
|
CAS#: 886366-59-2 Product: 1-(2-Nitrophenyl)cyclopropanamine No suppilers available for the product. |
| Name | 1-(2-Nitrophenyl)cyclopropanamine |
|---|---|
| Synonyms | 1-(2-Nitro-phenyl)-cyclopropylamine; Cyclopropanamine, 1-(2-nitrophenyl)- |
| Molecular Structure |  |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 |
| CAS Registry Number | 886366-59-2 |
| SMILES | c1ccc(c(c1)C2(CC2)N)[N+](=O)[O-] |
| InChI | 1S/C9H10N2O2/c10-9(5-6-9)7-3-1-2-4-8(7)11(12)13/h1-4H,5-6,10H2 |
| InChIKey | ZCYDXTRIRKXKFB-UHFFFAOYSA-N |
| Density | 1.317g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.432°C at 760 mmHg (Cal.) |
| Flash point | 139.73°C (Cal.) |
| Refractive index | 1.632 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Nitrophenyl)cyclopropanamine |