Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Astatech, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (215) 785-3197 | |||
|
sales@astatechinc.com | |||
| Chemical manufacturer since 1996 | ||||
| Name | 3-Amino-3-(3-phenoxyphenyl)-1-propanol |
|---|---|
| Synonyms | 3-(3-phenoxyphenyl)-DL-β-alaninol; 3-Amino-3-(3-phenoxy-phenyl)-propan-1-ol; DL-Å-(3-Phenoxyphenyl)alaninol |
| Molecular Structure |  |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.30 |
| CAS Registry Number | 886366-70-7 |
| SMILES | OCCC(N)c2cc(Oc1ccccc1)ccc2 |
| InChI | 1S/C15H17NO2/c16-15(9-10-17)12-5-4-8-14(11-12)18-13-6-2-1-3-7-13/h1-8,11,15,17H,9-10,16H2 |
| InChIKey | OYWAHXNHRLBPHL-UHFFFAOYSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.686°C at 760 mmHg (Cal.) |
| Flash point | 203.99°C (Cal.) |
| Refractive index | 1.596 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-3-(3-phenoxyphenyl)-1-propanol |