Online Database of Chemicals from Around the World
|
CAS#: 88641-44-5 Product: Retinyl Heptanoate No suppilers available for the product. |
| Name | Retinyl Heptanoate |
|---|---|
| Synonyms | retinyl heptanoate |
| Molecular Structure |  |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.60 |
| CAS Registry Number | 88641-44-5 |
| EINECS | 289-433-6 |
| SMILES | CC1(C)CCCC(\C)=C1\C=C\C(\C)=C\C=C\C(\C)=C\C(=O)OC(=O)CCCCCC |
| InChI | 1S/C27H40O3/c1-7-8-9-10-16-25(28)30-26(29)20-22(3)14-11-13-21(2)17-18-24-23(4)15-12-19-27(24,5)6/h11,13-14,17-18,20H,7-10,12,15-16,19H2,1-6H3/b14-11+,18-17+,21-13+,22-20+ |
| InChIKey | WOCSZWGRFOZCKT-NDTUGLLYSA-N |
| Density | 0.985g/cm3 (Cal.) |
|---|---|
| Boiling point | 547.553°C at 760 mmHg (Cal.) |
| Flash point | 255.31°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Retinyl Heptanoate |