Online Database of Chemicals from Around the World
| Aroz Technologies, LLC | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (877) 818-2125 | |||
 |
sales@aroztech.com | |||
| Chemical manufacturer | ||||
| Name | 5-(3-Formylphenyl)-2-furaldehyde |
|---|---|
| Synonyms | 5-(3-Formyl-phenyl)-furan-2-carbaldehyde; ZINC04312944 |
| Molecular Structure |  |
| Molecular Formula | C12H8O3 |
| Molecular Weight | 200.19 |
| CAS Registry Number | 886509-16-6 |
| SMILES | O=Cc2oc(c1cc(C=O)ccc1)cc2 |
| InChI | 1S/C12H8O3/c13-7-9-2-1-3-10(6-9)12-5-4-11(8-14)15-12/h1-8H |
| InChIKey | AUTGTTOFPBKQAX-UHFFFAOYSA-N |
| Density | 1.245g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.92°C at 760 mmHg (Cal.) |
| Flash point | 190.778°C (Cal.) |
| Refractive index | 1.622 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(3-Formylphenyl)-2-furaldehyde |