|
CAS#: 887352-92-3 Product: N-[4-(Benzyloxy)-3-sulfanylphenyl]acetamide No suppilers available for the product. |
| Name | N-[4-(Benzyloxy)-3-sulfanylphenyl]acetamide |
|---|---|
| Synonyms | 2-Benzyloxy-5-acetaminobenzenethiol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.35 |
| CAS Registry Number | 887352-92-3 |
| SMILES | O=C(Nc2cc(S)c(OCc1ccccc1)cc2)C |
| InChI | 1S/C15H15NO2S/c1-11(17)16-13-7-8-14(15(19)9-13)18-10-12-5-3-2-4-6-12/h2-9,19H,10H2,1H3,(H,16,17) |
| InChIKey | RAEVGIDMILXZIH-UHFFFAOYSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.669°C at 760 mmHg (Cal.) |
| Flash point | 254.176°C (Cal.) |
| Refractive index | 1.647 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(Benzyloxy)-3-sulfanylphenyl]acetamide |