Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (919) 678-0702 | |||
|
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | Ethyl 5-(3-iodophenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| Synonyms | ethyl 5-(3-iodophenyl)isoxazole-4-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C12H10INO3 |
| Molecular Weight | 343.12 |
| CAS Registry Number | 887407-86-5 |
| SMILES | O=C(OCC)c2cnoc2c1cc(I)ccc1 |
| InChI | 1S/C12H10INO3/c1-2-16-12(15)10-7-14-17-11(10)8-4-3-5-9(13)6-8/h3-7H,2H2,1H3 |
| InChIKey | JYFAZZWIIYXETI-UHFFFAOYSA-N |
| Density | 1.656g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.141°C at 760 mmHg (Cal.) |
| Flash point | 227.852°C (Cal.) |
| Refractive index | 1.596 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 5-(3-iodophenyl)-1,2-oxazole-4-carboxylate |