Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (919) 678-0702 | |||
|
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | Ethyl 3-[5-(3-nitrophenyl)-2-furyl]-3-oxopropanoate |
|---|---|
| Synonyms | Ethyl-2-[5-(3-Nitrophenyl)]furoyl-acetate |
| Molecular Structure | ![CAS#: 887411-69-0， Ethyl 3-[5-(3-nitrophenyl)-2-furyl]-3-oxopropanoate](/moreStructures/887411-69-0.gif) |
| Molecular Formula | C15H13NO6 |
| Molecular Weight | 303.27 |
| CAS Registry Number | 887411-69-0 |
| SMILES | O=C(CC(=O)OCC)c1ccc(o1)c2cc(ccc2)[N+]([O-])=O |
| InChI | 1S/C15H13NO6/c1-2-21-15(18)9-12(17)14-7-6-13(22-14)10-4-3-5-11(8-10)16(19)20/h3-8H,2,9H2,1H3 |
| InChIKey | AACJONATZIVGCR-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.25°C at 760 mmHg (Cal.) |
| Flash point | 233.361°C (Cal.) |
| Refractive index | 1.557 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-[5-(3-nitrophenyl)-2-furyl]-3-oxopropanoate |