Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Beta Pharma Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (203) 315-5062 / (877) 786-1922 | |||
|
sales@betapharma.com, | |||
| Chemical manufacturer | ||||
| Name | 3,5-Dichloro-4-hydrazinobenzoic acid |
|---|---|
| Synonyms | 3,5-Dichlor-4-hydrazinobenzoesäure; 3,5-Dichloro-4-hydrazinobenzoic acid; 3,5-DICHLORO-4-HYDRAZINO-BENZOICACID |
| Molecular Structure |  |
| Molecular Formula | C7H6Cl2N2O2 |
| Molecular Weight | 221.04 |
| CAS Registry Number | 887577-44-8 |
| SMILES | c1c(cc(c(c1Cl)NN)Cl)C(=O)O |
| InChI | 1S/C7H6Cl2N2O2/c8-4-1-3(7(12)13)2-5(9)6(4)11-10/h1-2,11H,10H2,(H,12,13) |
| InChIKey | JXZKCSOXIGTELP-UHFFFAOYSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.1±42.0°C at 760 mmHg (Cal.) |
| Flash point | 168.6±27.9°C (Cal.) |
| Refractive index | 1.705 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dichloro-4-hydrazinobenzoic acid |