Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Beta Pharma Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (203) 315-5062 / (877) 786-1922 | |||
|
sales@betapharma.com, | |||
| Chemical manufacturer | ||||
| Name | 3-(3-Aminophenoxy)-N,N-dimethylaniline |
|---|---|
| Synonyms | 3-(3-Aminophenoxy)-N,N-dimethylanilin; 3-(3-Aminophenoxy)-N,N-dimethylaniline; 3-(3-Aminophénoxy)-N,N-diméthylaniline |
| Molecular Structure |  |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 |
| CAS Registry Number | 887580-35-0 |
| SMILES | CN(C)c1cccc(c1)Oc2cccc(c2)N |
| InChI | 1S/C14H16N2O/c1-16(2)12-6-4-8-14(10-12)17-13-7-3-5-11(15)9-13/h3-10H,15H2,1-2H3 |
| InChIKey | IQDSHBJNQRGTBT-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.5±22.0°C at 760 mmHg (Cal.) |
| Flash point | 184.5±22.3°C (Cal.) |
| Refractive index | 1.63 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3-Aminophenoxy)-N,N-dimethylaniline |