Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3-Amino-3-(5,6,7,8-tetrahydro-2-naphthalenyl)propanoic acid |
|---|---|
| Synonyms | 2-NAPHTHALENEPROPANOICACID, B-AMINO-5,6,7,8-TETRAHYDRO-; 3-(5,6,7,8-tetrahydro-2-naphthalenyl)-β-alanine; 3-AMINO-3-(5,6,7,8-TETRAHYDRO-NAPHTHALEN-2-YL)-PROPIONICACID |
| Molecular Structure |  |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 |
| CAS Registry Number | 887586-55-2 |
| SMILES | OC(=O)CC(N)c1ccc2CCCCc2c1 |
| InChI | 1S/C13H17NO2/c14-12(8-13(15)16)11-6-5-9-3-1-2-4-10(9)7-11/h5-7,12H,1-4,8,14H2,(H,15,16) |
| InChIKey | GPQHIVDSBJLOKO-UHFFFAOYSA-N |
| Density | 1.188g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.201°C at 760 mmHg (Cal.) |
| Flash point | 194.625°C (Cal.) |
| Refractive index | 1.59 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-3-(5,6,7,8-tetrahydro-2-naphthalenyl)propanoic acid |