Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Beta Pharma Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (203) 315-5062 / (877) 786-1922 | |||
|
sales@betapharma.com, | |||
| Chemical manufacturer | ||||
| Name | 3-[3-(4-Morpholinyl)phenyl]-3-oxopropanenitrile |
|---|---|
| Synonyms | 3-(3-MORPHOLIN-4-YL-PHENYL)-3-OXO-PROPIONITRILE; 3-[3-(4-Morpholinyl)phenyl]-3-oxopropanenitrile; 3-[3-(4-Morpholinyl)phényl]-3-oxopropanenitrile |
| Molecular Structure | ![CAS#: 887591-28-8， 3-[3-(4-Morpholinyl)phenyl]-3-oxopropanenitrile](/moreStructures/887591-28-8.gif) |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.26 |
| CAS Registry Number | 887591-28-8 |
| SMILES | c1cc(cc(c1)N2CCOCC2)C(=O)CC#N |
| InChI | 1S/C13H14N2O2/c14-5-4-13(16)11-2-1-3-12(10-11)15-6-8-17-9-7-15/h1-3,10H,4,6-9H2 |
| InChIKey | BVIYQRQIFHQBSJ-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.8±45.0°C at 760 mmHg (Cal.) |
| Flash point | 236.7±28.7°C (Cal.) |
| Refractive index | 1.558 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[3-(4-Morpholinyl)phenyl]-3-oxopropanenitrile |