Online Database of Chemicals from Around the World
|
CAS#: 887592-32-7 Product: 7-Bromo-4-chloro-2-(trifluoromethyl)quinazoline No suppilers available for the product. |
| Name | 7-Bromo-4-chloro-2-(trifluoromethyl)quinazoline |
|---|---|
| Synonyms | 7-Brom-4-chlor-2-(trifluormethyl)chinazolin; 7-Bromo-4-chloro-2-(trifluoromethyl)quinazoline; 7-Bromo-4-chloro-2-(trifluorométhyl)quinazoline |
| Molecular Structure |  |
| Molecular Formula | C9H3BrClF3N2 |
| Molecular Weight | 311.49 |
| CAS Registry Number | 887592-32-7 |
| SMILES | c1cc2c(cc1Br)nc(nc2Cl)C(F)(F)F |
| InChI | 1S/C9H3BrClF3N2/c10-4-1-2-5-6(3-4)15-8(9(12,13)14)16-7(5)11/h1-3H |
| InChIKey | VUSHNWRGQDDPJU-UHFFFAOYSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 227.3±40.0°C at 760 mmHg (Cal.) |
| Flash point | 91.3±27.3°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Bromo-4-chloro-2-(trifluoromethyl)quinazoline |