Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl methyl[(trimethylsilyl)ethynyl]carbamate |
|---|---|
| Synonyms | methyl methyl((trimethylsilyl)ethynyl)carbamate |
| Molecular Structure | ![CAS#: 888015-57-4， Methyl methyl[(trimethylsilyl)ethynyl]carbamate](/moreStructures/888015-57-4.gif) |
| Molecular Formula | C8H15NO2Si |
| Molecular Weight | 185.30 |
| CAS Registry Number | 888015-57-4 |
| SMILES | CN(C#C[Si](C)(C)C)C(=O)OC |
| InChI | 1S/C8H15NO2Si/c1-9(8(10)11-2)6-7-12(3,4)5/h1-5H3 |
| InChIKey | IVONZWOLWOYDTK-UHFFFAOYSA-N |
| Density | 0.973g/cm3 (Cal.) |
|---|---|
| Boiling point | 191.852°C at 760 mmHg (Cal.) |
| Flash point | 69.83°C (Cal.) |
| Refractive index | 1.452 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl methyl[(trimethylsilyl)ethynyl]carbamate |