Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (919) 678-0702 | |||
|
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | 1-[3-(3-Fluorophenyl)-1,2-oxazol-5-yl]ethanol |
|---|---|
| Synonyms | 5(1-hydroxyethyl)-3(3-fluorophenyl)-isoxazole; 5-ISOXAZOLEMETHANOL,3-(3-FLUOROPHENYL)-A-METHYL- |
| Molecular Structure | ![CAS#: 889938-98-1， 1-[3-(3-Fluorophenyl)-1,2-oxazol-5-yl]ethanol](/moreStructures/889938-98-1.gif) |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 |
| CAS Registry Number | 889938-98-1 |
| SMILES | CC(O)c1cc(no1)c2cc(F)ccc2 |
| InChI | 1S/C11H10FNO2/c1-7(14)11-6-10(13-15-11)8-3-2-4-9(12)5-8/h2-7,14H,1H3 |
| InChIKey | ASTLODQXKPDEBN-UHFFFAOYSA-N |
| Density | 1.248g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.652°C at 760 mmHg (Cal.) |
| Flash point | 178.569°C (Cal.) |
| Refractive index | 1.542 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-(3-Fluorophenyl)-1,2-oxazol-5-yl]ethanol |