Online Database of Chemicals from Around the World
| Rieke Metals, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (402) 434-2775 | |||
 |
sales@riekemetals.com | |||
| Chemical manufacturer | ||||
| Name | 3-(Pentafluorobenzoyl)phenyl acetate |
|---|---|
| Synonyms | 3-Acetoxy-2',3',4',5',6'-pentafluorobenzophenone |
| Molecular Structure |  |
| Molecular Formula | C15H7F5O3 |
| Molecular Weight | 330.21 |
| CAS Registry Number | 890099-26-0 |
| SMILES | O=C(C)Oc1cc(ccc1)C(=O)c2c(F)c(F)c(F)c(F)c2F |
| InChI | 1S/C15H7F5O3/c1-6(21)23-8-4-2-3-7(5-8)15(22)9-10(16)12(18)14(20)13(19)11(9)17/h2-5H,1H3 |
| InChIKey | MIPXQKTWTQXBKD-UHFFFAOYSA-N |
| Density | 1.46g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.765°C at 760 mmHg (Cal.) |
| Flash point | 197.485°C (Cal.) |
| Refractive index | 1.507 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(Pentafluorobenzoyl)phenyl acetate |