Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 7-Methoxy-1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| Synonyms | Cyclopent[b]indole,1,2,3,4-tetrahydro-7-methoxy- |
| Molecular Structure | ![CAS#: 89169-57-3， 7-Methoxy-1,2,3,4-tetrahydrocyclopenta[b]indole](/moreStructures/89169-57-3.gif) |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 |
| CAS Registry Number | 89169-57-3 |
| SMILES | COc1ccc2c(c1)c3c([nH]2)CCC3 |
| InChI | 1S/C12H13NO/c1-14-8-5-6-12-10(7-8)9-3-2-4-11(9)13-12/h5-7,13H,2-4H2,1H3 |
| InChIKey | HONJGUSMTAVGKM-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.501°C at 760 mmHg (Cal.) |
| Flash point | 124.899°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methoxy-1,2,3,4-tetrahydrocyclopenta[b]indole |