|
CAS#: 891782-59-5 Product: 1H-Indazole-3,6-dicarboxylic acid No suppilers available for the product. |
| Name | 1H-Indazole-3,6-dicarboxylic acid |
|---|---|
| Synonyms | 1H-Indazol-3,6-dicarbonsäure; 1H-Indazole-3,6-dicarboxylic acid; 1H-INDAZOLE-3,6-DICARBOXYLICACID |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.15 |
| CAS Registry Number | 891782-59-5 |
| SMILES | c1cc2c(cc1C(=O)O)[nH]nc2C(=O)O |
| InChI | 1S/C9H6N2O4/c12-8(13)4-1-2-5-6(3-4)10-11-7(5)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | XCCZREWYCPFOSG-UHFFFAOYSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 607.9±35.0°C at 760 mmHg (Cal.) |
| Flash point | 321.5±25.9°C (Cal.) |
| Refractive index | 1.781 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Indazole-3,6-dicarboxylic acid |