Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (1R,3S)-1-Amino-1,3-cyclopentanedicarboxylic acid |
|---|---|
| Synonyms | (1R,3S)1-AMINOCYCLOPENTAN E 1,3-DICARBOXYLIC ACID; (1R,3S)-1-Amino-cyclopentane-1,3-dicarboxylic acid; 1,3-Cyclopentanedicarboxylic acid, 1-amino-, trans- |
| Molecular Structure |  |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 |
| CAS Registry Number | 89253-38-3 |
| SMILES | C1C[C@@](C[C@H]1C(=O)O)(C(=O)O)N |
| InChI | 1S/C7H11NO4/c8-7(6(11)12)2-1-4(3-7)5(9)10/h4H,1-3,8H2,(H,9,10)(H,11,12)/t4-,7+/m0/s1 |
| InChIKey | YFYNOWXBIBKGHB-MHTLYPKNSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.7±42.0°C at 760 mmHg (Cal.) |
| Flash point | 167.1±27.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,3S)-1-Amino-1,3-cyclopentanedicarboxylic acid |