Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BioBlocks Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (858) 558-5900 | |||
|
sales@bioblocks.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl 6-ethyl-2-methyl-3-quinolinecarboxylate |
|---|---|
| Synonyms | 6-ethyl-2-methyl quinoline-3-carboxylic acid ethyl ester; 6-Ethyl-2-methylquinoline-3-carboxylic acid ethyl ester |
| Molecular Structure |  |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.30 |
| CAS Registry Number | 892874-68-9 |
| SMILES | CCOC(=O)c1cc2cc(ccc2nc1C)CC |
| InChI | 1S/C15H17NO2/c1-4-11-6-7-14-12(8-11)9-13(10(3)16-14)15(17)18-5-2/h6-9H,4-5H2,1-3H3 |
| InChIKey | ZCSLMAZHOOCIJE-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.565°C at 760 mmHg (Cal.) |
| Flash point | 160.373°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 6-ethyl-2-methyl-3-quinolinecarboxylate |