|
CAS#: 89295-32-9 Product: Ethyl 2-[(phenylsulfonyl)methyl]acrylate No suppilers available for the product. |
| Name | Ethyl 2-[(phenylsulfonyl)methyl]acrylate |
|---|---|
| Synonyms | 2-(Ethoxycarbonyl)prop-2-en-1-yl phenyl sulfone; AIDS131545; AIDS-131545 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.30 |
| CAS Registry Number | 89295-32-9 |
| SMILES | CCOC(=O)C(=C)CS(=O)(=O)C1=CC=CC=C1 |
| InChI | 1S/C12H14O4S/c1-3-16-12(13)10(2)9-17(14,15)11-7-5-4-6-8-11/h4-8H,2-3,9H2,1H3 |
| InChIKey | IPHGVOCQEKWURA-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.0±45.0°C at 760 mmHg (Cal.) |
| Flash point | 203.0±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-[(phenylsulfonyl)methyl]acrylate |