|
CAS#: 89315-18-4 Product: 4-[(1E)-2-(8,8-Dimethyl-5,6,7,8-tetrahydro-2-naphthalenyl)-1-propen-1-yl]benzoic acid No suppilers available for the product. |
| Name | 4-[(1E)-2-(8,8-Dimethyl-5,6,7,8-tetrahydro-2-naphthalenyl)-1-propen-1-yl]benzoic acid |
|---|---|
| Synonyms | (E)-4-(2- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.42 |
| CAS Registry Number | 89315-18-4 |
| SMILES | C/C(=C\C1=CC=C(C=C1)C(=O)O)/C2=CC3=C(CCCC3(C)C)C=C2 |
| InChI | 1S/C22H24O2/c1-15(13-16-6-8-18(9-7-16)21(23)24)19-11-10-17-5-4-12-22(2,3)20(17)14-19/h6-11,13-14H,4-5,12H2,1-3H3,(H,23,24)/b15-13+ |
| InChIKey | KZFIKZMCPAIKBF-FYWRMAATSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.0±44.0°C at 760 mmHg (Cal.) |
| Flash point | 220.3±23.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(1E)-2-(8,8-Dimethyl-5,6,7,8-tetrahydro-2-naphthalenyl)-1-propen-1-yl]benzoic acid |